C8H11N7OS2 — CID 80931173
[4-propoxy-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80931173) has the molecular formula C8H11N7OS2 and a molecular weight of 285.36 g/mol. Its IUPAC name is [4-propoxy-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-propoxy-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80931173 |
| Molecular Formula | C8H11N7OS2 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [4-propoxy-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(Sc2nncs2)n1 |
| InChI | InChI=1S/C8H11N7OS2/c1-2-3-16-6-11-5(14-9)12-7(13-6)18-8-15-10-4-17-8/h4H,2-3,9H2,1H3,(H,11,12,13,14) |
| InChIKey | HDKKORVJOWLMQQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|