C10H15N7OS — CID 80922420
[4-(1-methylimidazol-2-yl)sulfanyl-6-propoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80922420) has the molecular formula C10H15N7OS and a molecular weight of 281.35 g/mol. Its IUPAC name is [4-(1-methylimidazol-2-yl)sulfanyl-6-propoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(1-methylimidazol-2-yl)sulfanyl-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922420 |
| Molecular Formula | C10H15N7OS |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [4-(1-methylimidazol-2-yl)sulfanyl-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(Sc2nccn2C)n1 |
| InChI | InChI=1S/C10H15N7OS/c1-3-6-18-8-13-7(16-11)14-9(15-8)19-10-12-4-5-17(10)2/h4-5H,3,6,11H2,1-2H3,(H,13,14,15,16) |
| InChIKey | AHJWBFZBNUISQG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|