C10H13N7OS — CID 80924638
(4-propoxy-6-pyrimidin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine (PubChem CID 80924638) has the molecular formula C10H13N7OS and a molecular weight of 279.33 g/mol. Its IUPAC name is (4-propoxy-6-pyrimidin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine.
| Compound Name | (4-propoxy-6-pyrimidin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80924638 |
| Molecular Formula | C10H13N7OS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (4-propoxy-6-pyrimidin-2-ylsulfanyl-1,3,5-triazin-2-yl)hydrazine |
| SMILES | CCCOc1nc(NN)nc(Sc2ncccn2)n1 |
| InChI | InChI=1S/C10H13N7OS/c1-2-6-18-8-14-7(17-11)15-10(16-8)19-9-12-4-3-5-13-9/h3-5H,2,6,11H2,1H3,(H,14,15,16,17) |
| InChIKey | QCDGHTBGQIVIFV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|