C9H14N8S2 — CID 80931247
N,N-diethyl-4-hydrazinyl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 80931247) has the molecular formula C9H14N8S2 and a molecular weight of 298.40 g/mol. Its IUPAC name is N,N-diethyl-4-hydrazinyl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-hydrazinyl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80931247 |
| Molecular Formula | C9H14N8S2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N,N-diethyl-4-hydrazinyl-6-(1,3,4-thiadiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(NN)nc(Sc2nncs2)n1 |
| InChI | InChI=1S/C9H14N8S2/c1-3-17(4-2)7-12-6(15-10)13-8(14-7)19-9-16-11-5-18-9/h5H,3-4,10H2,1-2H3,(H,12,13,14,15) |
| InChIKey | UABVJHUEXMONSD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|