C12H18N8S — CID 80925367
N,N-diethyl-4-hydrazinyl-6-(4-methylpyrimidin-2-yl)sulfanyl-1,3,5-triazin-2-amine (PubChem CID 80925367) has the molecular formula C12H18N8S and a molecular weight of 306.40 g/mol. Its IUPAC name is N,N-diethyl-4-hydrazinyl-6-(4-methylpyrimidin-2-yl)sulfanyl-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-hydrazinyl-6-(4-methylpyrimidin-2-yl)sulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80925367 |
| Molecular Formula | C12H18N8S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N,N-diethyl-4-hydrazinyl-6-(4-methylpyrimidin-2-yl)sulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(NN)nc(Sc2nccc(C)n2)n1 |
| InChI | InChI=1S/C12H18N8S/c1-4-20(5-2)10-16-9(19-13)17-12(18-10)21-11-14-7-6-8(3)15-11/h6-7H,4-5,13H2,1-3H3,(H,16,17,18,19) |
| InChIKey | UAQLHARCLYGWPU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|