C11H21N7OS — CID 114235285
2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]sulfanyl]-N,N-dimethylacetamide (PubChem CID 114235285) has the molecular formula C11H21N7OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]sulfanyl]-N,N-dimethylacetamide.
| Compound Name | 2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]sulfanyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114235285 |
| Molecular Formula | C11H21N7OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[[4-(diethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]sulfanyl]-N,N-dimethylacetamide |
| SMILES | CCN(CC)c1nc(NN)nc(SCC(=O)N(C)C)n1 |
| InChI | InChI=1S/C11H21N7OS/c1-5-18(6-2)10-13-9(16-12)14-11(15-10)20-7-8(19)17(3)4/h5-7,12H2,1-4H3,(H,13,14,15,16) |
| InChIKey | NKRLXIJJEPWUNY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|