C12H25N7 — CID 80916617
4-N-butyl-2-N,2-N-diethyl-6-hydrazinyl-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 80916617) has the molecular formula C12H25N7 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-N-butyl-2-N,2-N-diethyl-6-hydrazinyl-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N,2-N-diethyl-6-hydrazinyl-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80916617 |
| Molecular Formula | C12H25N7 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 4-N-butyl-2-N,2-N-diethyl-6-hydrazinyl-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(C)c1nc(NN)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C12H25N7/c1-5-8-9-18(4)11-14-10(17-13)15-12(16-11)19(6-2)7-3/h5-9,13H2,1-4H3,(H,14,15,16,17) |
| InChIKey | XLZKJGNXPLDYAO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|