C11H24N8 — CID 101056119
N,N-dibutyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine (PubChem CID 101056119) has the molecular formula C11H24N8 and a molecular weight of 268.37 g/mol. Its IUPAC name is N,N-dibutyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine.
| Compound Name | N,N-dibutyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 101056119 |
| Molecular Formula | C11H24N8 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | N,N-dibutyl-4,6-dihydrazinyl-1,3,5-triazin-2-amine |
| SMILES | CCCCN(CCCC)c1nc(NN)nc(NN)n1 |
| InChI | InChI=1S/C11H24N8/c1-3-5-7-19(8-6-4-2)11-15-9(17-12)14-10(16-11)18-13/h3-8,12-13H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | SNJREHKGYFKKKC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|