C12H25N7O2 — CID 80899825
6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80899825) has the molecular formula C12H25N7O2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80899825 |
| Molecular Formula | C12H25N7O2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 6-hydrazinyl-2-N-(2-methoxyethyl)-2-N-(3-methoxypropyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COCCCN(CCOC)c1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H25N7O2/c1-18(2)11-14-10(17-13)15-12(16-11)19(7-9-21-4)6-5-8-20-3/h5-9,13H2,1-4H3,(H,14,15,16,17) |
| InChIKey | OCBABVJHXBZFJF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|