C11H22N8O2 — CID 80900030
2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 80900030) has the molecular formula C11H22N8O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 80900030 |
| Molecular Formula | C11H22N8O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)c1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H22N8O2/c1-18(2)10-14-9(17-12)15-11(16-10)19(3)7-8(20)13-5-6-21-4/h5-7,12H2,1-4H3,(H,13,20)(H,14,15,16,17) |
| InChIKey | IVMQMFWZDFOZEJ-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|