C9H13Cl2N5O2 — CID 55023792
2-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 55023792) has the molecular formula C9H13Cl2N5O2 and a molecular weight of 294.14 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 55023792 |
| Molecular Formula | C9H13Cl2N5O2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C9H13Cl2N5O2/c1-16(5-6(17)12-3-4-18-2)9-14-7(10)13-8(11)15-9/h3-5H2,1-2H3,(H,12,17) |
| InChIKey | GJDQDJFOLWOPAI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|