C10H14BrClN4O2 — CID 114071706
2-[(5-bromo-6-chloropyrimidin-4-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 114071706) has the molecular formula C10H14BrClN4O2 and a molecular weight of 337.61 g/mol. Its IUPAC name is 2-[(5-bromo-6-chloropyrimidin-4-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(5-bromo-6-chloropyrimidin-4-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 114071706 |
| Molecular Formula | C10H14BrClN4O2 |
| Molecular Weight | 337.61 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 2-[(5-bromo-6-chloropyrimidin-4-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)c1ncnc(Cl)c1Br |
| InChI | InChI=1S/C10H14BrClN4O2/c1-16(5-7(17)13-3-4-18-2)10-8(11)9(12)14-6-15-10/h6H,3-5H2,1-2H3,(H,13,17) |
| InChIKey | SZENEMAHSZBHBB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.61 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|