C11H19N5O2 — CID 80806380
N-(2-methoxyethyl)-2-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]acetamide (PubChem CID 80806380) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 80806380 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]acetamide |
| SMILES | CNc1cc(N(C)CC(=O)NCCOC)ncn1 |
| InChI | InChI=1S/C11H19N5O2/c1-12-9-6-10(15-8-14-9)16(2)7-11(17)13-4-5-18-3/h6,8H,4-5,7H2,1-3H3,(H,13,17)(H,12,14,15) |
| InChIKey | GDXUNRAAQZJAMB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|