C10H17N5O2 — CID 80652005
2-[(5-aminopyrazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 80652005) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-[(5-aminopyrazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(5-aminopyrazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 80652005 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-[(5-aminopyrazin-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)c1cnc(N)cn1 |
| InChI | InChI=1S/C10H17N5O2/c1-15(7-10(16)12-3-4-17-2)9-6-13-8(11)5-14-9/h5-6H,3-4,7H2,1-2H3,(H2,11,13)(H,12,16) |
| InChIKey | DDKVFAUWVDOFLO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|