C11H18BrN5O — CID 114072094
2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]-methylamino]-N-ethylacetamide (PubChem CID 114072094) has the molecular formula C11H18BrN5O and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]-methylamino]-N-ethylacetamide.
| Compound Name | 2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]-methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 114072094 |
| Molecular Formula | C11H18BrN5O |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[[5-bromo-6-(ethylamino)pyrimidin-4-yl]-methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(C)c1ncnc(NCC)c1Br |
| InChI | InChI=1S/C11H18BrN5O/c1-4-13-8(18)6-17(3)11-9(12)10(14-5-2)15-7-16-11/h7H,4-6H2,1-3H3,(H,13,18)(H,14,15,16) |
| InChIKey | YJHBGEQCQLRXBP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |