C11H19BrN4O — CID 114072576
5-bromo-4-N-(2-ethoxyethyl)-6-N-ethyl-4-N-methylpyrimidine-4,6-diamine (PubChem CID 114072576) has the molecular formula C11H19BrN4O and a molecular weight of 303.20 g/mol. Its IUPAC name is 5-bromo-4-N-(2-ethoxyethyl)-6-N-ethyl-4-N-methylpyrimidine-4,6-diamine.
| Compound Name | 5-bromo-4-N-(2-ethoxyethyl)-6-N-ethyl-4-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114072576 |
| Molecular Formula | C11H19BrN4O |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-bromo-4-N-(2-ethoxyethyl)-6-N-ethyl-4-N-methylpyrimidine-4,6-diamine |
| SMILES | CCNc1ncnc(N(C)CCOCC)c1Br |
| InChI | InChI=1S/C11H19BrN4O/c1-4-13-10-9(12)11(15-8-14-10)16(3)6-7-17-5-2/h8H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | NHJFQUOWCCCBTP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|