C10H16ClN3O3S — CID 80692696
2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 80692696) has the molecular formula C10H16ClN3O3S and a molecular weight of 293.78 g/mol. Its IUPAC name is 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 80692696 |
| Molecular Formula | C10H16ClN3O3S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)c1nc(Cl)c(CO)s1 |
| InChI | InChI=1S/C10H16ClN3O3S/c1-14(5-8(16)12-3-4-17-2)10-13-9(11)7(6-15)18-10/h15H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | PKSHRDUSRWHONM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|