C10H17ClN2O2S — CID 107200937
5-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]pentan-1-ol (PubChem CID 107200937) has the molecular formula C10H17ClN2O2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 5-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]pentan-1-ol.
| Compound Name | 5-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107200937 |
| Molecular Formula | C10H17ClN2O2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-[[4-chloro-5-(hydroxymethyl)-1,3-thiazol-2-yl]-methylamino]pentan-1-ol |
| SMILES | CN(CCCCCO)c1nc(Cl)c(CO)s1 |
| InChI | InChI=1S/C10H17ClN2O2S/c1-13(5-3-2-4-6-14)10-12-9(11)8(7-15)16-10/h14-15H,2-7H2,1H3 |
| InChIKey | UOQJZMPLPSXMJX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|