C9H17N3OS — CID 107197781
5-[(5-amino-1,3-thiazol-2-yl)-methylamino]pentan-1-ol (PubChem CID 107197781) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-[(5-amino-1,3-thiazol-2-yl)-methylamino]pentan-1-ol.
| Compound Name | 5-[(5-amino-1,3-thiazol-2-yl)-methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107197781 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-[(5-amino-1,3-thiazol-2-yl)-methylamino]pentan-1-ol |
| SMILES | CN(CCCCCO)c1ncc(N)s1 |
| InChI | InChI=1S/C9H17N3OS/c1-12(5-3-2-4-6-13)9-11-7-8(10)14-9/h7,13H,2-6,10H2,1H3 |
| InChIKey | FRYKFMCQFPBTPN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|