C9H15ClN4O3 — CID 106957148
2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 106957148) has the molecular formula C9H15ClN4O3 and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 106957148 |
| Molecular Formula | C9H15ClN4O3 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)c1nnc(CCl)o1 |
| InChI | InChI=1S/C9H15ClN4O3/c1-14(6-7(15)11-3-4-16-2)9-13-12-8(5-10)17-9/h3-6H2,1-2H3,(H,11,15) |
| InChIKey | YMTOETYDPJLGAJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|