C9H19N3O3 — CID 47128037
2-[ethylcarbamoyl(methyl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 47128037) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[ethylcarbamoyl(methyl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[ethylcarbamoyl(methyl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 47128037 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 2-[ethylcarbamoyl(methyl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCNC(=O)N(C)CC(=O)NCCOC |
| InChI | InChI=1S/C9H19N3O3/c1-4-10-9(14)12(2)7-8(13)11-5-6-15-3/h4-7H2,1-3H3,(H,10,14)(H,11,13) |
| InChIKey | SQYHLYGABDNHNP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|