C10H21N7O — CID 80896663
2-N-ethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 80896663) has the molecular formula C10H21N7O and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-N-ethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-ethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80896663 |
| Molecular Formula | C10H21N7O |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-N-ethyl-6-hydrazinyl-2-N-(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CCOC)c1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H21N7O/c1-5-17(6-7-18-4)10-13-8(15-11)12-9(14-10)16(2)3/h5-7,11H2,1-4H3,(H,12,13,14,15) |
| InChIKey | ILBGVQMMASYTDO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|