C11H22N6O2 — CID 80795772
2-N,2-N-bis(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80795772) has the molecular formula C11H22N6O2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-N,2-N-bis(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-bis(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80795772 |
| Molecular Formula | C11H22N6O2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-N,2-N-bis(2-methoxyethyl)-4-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCCN(CCOC)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H22N6O2/c1-16(2)10-13-9(12)14-11(15-10)17(5-7-18-3)6-8-19-4/h5-8H2,1-4H3,(H2,12,13,14,15) |
| InChIKey | ZWPCSDPSXGXDSW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |