About 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine
6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 793255) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
Analyze 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine?
The IUPAC name of 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (CID 793255) is 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
What is the SMILES notation for 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine?
The canonical SMILES for 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine is COc1nc(N)nc(N(C)C)n1.
What is the InChIKey of 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine?
The InChIKey is CWGBAMKHDKOACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O/c1-11(2)5-8-4(7)9-6(10-5)12-3/h1-3H3,(H2,7,8,9,10).
What are the key properties of 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine?
6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine has a molecular weight of 169.19 g/mol, XLogP of -0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine is sourced from PubChem (CID 793255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).