C4H7N5O — CID 17803
6-methoxy-1,3,5-triazine-2,4-diamine (PubChem CID 17803) has the molecular formula C4H7N5O and a molecular weight of 141.13 g/mol. Its IUPAC name is 6-methoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17803 |
| Molecular Formula | C4H7N5O |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 6-methoxy-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H7N5O/c1-10-4-8-2(5)7-3(6)9-4/h1H3,(H4,5,6,7,8,9) |
| InChIKey | XVMFICQRQHBOOT-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |