C6H9N3O3 — CID 13419
2,4,6-trimethoxy-1,3,5-triazine (PubChem CID 13419) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 2,4,6-trimethoxy-1,3,5-triazine.
| Compound Name | 2,4,6-trimethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 13419 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2,4,6-trimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C6H9N3O3/c1-10-4-7-5(11-2)9-6(8-4)12-3/h1-3H3 |
| InChIKey | DFUGJTBMQKRCPI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |