C9H15N3O3 — CID 13440
2,4,6-triethoxy-1,3,5-triazine (PubChem CID 13440) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2,4,6-triethoxy-1,3,5-triazine.
| Compound Name | 2,4,6-triethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 13440 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2,4,6-triethoxy-1,3,5-triazine |
| SMILES | CCOc1nc(OCC)nc(OCC)n1 |
| InChI | InChI=1S/C9H15N3O3/c1-4-13-7-10-8(14-5-2)12-9(11-7)15-6-3/h4-6H2,1-3H3 |
| InChIKey | ZLKYBXDNXFQYDL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |