C5H9N5O — CID 17802
6-ethoxy-1,3,5-triazine-2,4-diamine (PubChem CID 17802) has the molecular formula C5H9N5O and a molecular weight of 155.16 g/mol. Its IUPAC name is 6-ethoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17802 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 6-ethoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C5H9N5O/c1-2-11-5-9-3(6)8-4(7)10-5/h2H2,1H3,(H4,6,7,8,9,10) |
| InChIKey | BVZPBJHXLZKTKX-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |