C15H27N3O3 — CID 29832
2,4,6-tributoxy-1,3,5-triazine (PubChem CID 29832) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2,4,6-tributoxy-1,3,5-triazine.
| Compound Name | 2,4,6-tributoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 29832 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2,4,6-tributoxy-1,3,5-triazine |
| SMILES | CCCCOc1nc(OCCCC)nc(OCCCC)n1 |
| InChI | InChI=1S/C15H27N3O3/c1-4-7-10-19-13-16-14(20-11-8-5-2)18-15(17-13)21-12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | RFWINRJWJPNZQG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|