C4H5ClN4O — CID 23689
4-chloro-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 23689) has the molecular formula C4H5ClN4O and a molecular weight of 160.56 g/mol. Its IUPAC name is 4-chloro-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23689 |
| Molecular Formula | C4H5ClN4O |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 4-chloro-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C4H5ClN4O/c1-10-4-8-2(5)7-3(6)9-4/h1H3,(H2,6,7,8,9) |
| InChIKey | FTCKIHUQOCAWCJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |