C10H18N4O2 — CID 115978115
2-N,2-N-bis(2-methoxyethyl)pyrimidine-2,4-diamine (PubChem CID 115978115) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-N,2-N-bis(2-methoxyethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N-bis(2-methoxyethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 115978115 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-N,2-N-bis(2-methoxyethyl)pyrimidine-2,4-diamine |
| SMILES | COCCN(CCOC)c1nccc(N)n1 |
| InChI | InChI=1S/C10H18N4O2/c1-15-7-5-14(6-8-16-2)10-12-4-3-9(11)13-10/h3-4H,5-8H2,1-2H3,(H2,11,12,13) |
| InChIKey | ZLWMJGIHZQOIIV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |