C7H12N4O — CID 83695203
2-N-(2-methoxyethyl)pyrimidine-2,4-diamine (PubChem CID 83695203) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 83695203 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
| SMILES | COCCNc1nccc(N)n1 |
| InChI | InChI=1S/C7H12N4O/c1-12-5-4-10-7-9-3-2-6(8)11-7/h2-3H,4-5H2,1H3,(H3,8,9,10,11) |
| InChIKey | LFVCXHICFKNQSV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|