C11H19N3O — CID 156651791
5-N-(2-methoxyethyl)-5-N-propylpyridine-2,5-diamine (PubChem CID 156651791) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-N-(2-methoxyethyl)-5-N-propylpyridine-2,5-diamine.
| Compound Name | 5-N-(2-methoxyethyl)-5-N-propylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 156651791 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-N-(2-methoxyethyl)-5-N-propylpyridine-2,5-diamine |
| SMILES | CCCN(CCOC)c1ccc(N)nc1 |
| InChI | InChI=1S/C11H19N3O/c1-3-6-14(7-8-15-2)10-4-5-11(12)13-9-10/h4-5,9H,3,6-8H2,1-2H3,(H2,12,13) |
| InChIKey | MEZCLKNDLQFFQR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |