C12H20N2O2 — CID 43587927
3-N,3-N-bis(2-methoxyethyl)benzene-1,3-diamine (PubChem CID 43587927) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-N,3-N-bis(2-methoxyethyl)benzene-1,3-diamine.
| Compound Name | 3-N,3-N-bis(2-methoxyethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 43587927 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-N,3-N-bis(2-methoxyethyl)benzene-1,3-diamine |
| SMILES | COCCN(CCOC)c1cccc(N)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-15-8-6-14(7-9-16-2)12-5-3-4-11(13)10-12/h3-5,10H,6-9,13H2,1-2H3 |
| InChIKey | KTHYGXWCNGNGOO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|