C12H18BrNO2 — CID 146003902
3-bromo-N,N-bis(2-methoxyethyl)aniline (PubChem CID 146003902) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 3-bromo-N,N-bis(2-methoxyethyl)aniline.
| Compound Name | 3-bromo-N,N-bis(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 146003902 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-bromo-N,N-bis(2-methoxyethyl)aniline |
| SMILES | COCCN(CCOC)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrNO2/c1-15-8-6-14(7-9-16-2)12-5-3-4-11(13)10-12/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | VVDXULPWRFJZBI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |