C10H17N5O3 — CID 136906918
N'-hydroxy-2-[2-hydroxyethyl(2-methoxyethyl)amino]pyrimidine-4-carboximidamide (PubChem CID 136906918) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is N'-hydroxy-2-[2-hydroxyethyl(2-methoxyethyl)amino]pyrimidine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-[2-hydroxyethyl(2-methoxyethyl)amino]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136906918 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N'-hydroxy-2-[2-hydroxyethyl(2-methoxyethyl)amino]pyrimidine-4-carboximidamide |
| SMILES | COCCN(CCO)c1nccc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C10H17N5O3/c1-18-7-5-15(4-6-16)10-12-3-2-8(13-10)9(11)14-17/h2-3,16-17H,4-7H2,1H3,(H2,11,14) |
| InChIKey | HBYBBKNEGLRFDF-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|