C13H23N5O3 — CID 136906893
2-[bis(2-ethoxyethyl)amino]-N'-hydroxypyrimidine-4-carboximidamide (PubChem CID 136906893) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[bis(2-ethoxyethyl)amino]-N'-hydroxypyrimidine-4-carboximidamide.
| Compound Name | 2-[bis(2-ethoxyethyl)amino]-N'-hydroxypyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136906893 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-[bis(2-ethoxyethyl)amino]-N'-hydroxypyrimidine-4-carboximidamide |
| SMILES | CCOCCN(CCOCC)c1nccc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C13H23N5O3/c1-3-20-9-7-18(8-10-21-4-2)13-15-6-5-11(16-13)12(14)17-19/h5-6,19H,3-4,7-10H2,1-2H3,(H2,14,17) |
| InChIKey | DZTIMEQMXTZFCF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|