C11H22N6 — CID 80773692
2-N-ethyl-4-N,4-N,6-N-trimethyl-2-N-propyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80773692) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is 2-N-ethyl-4-N,4-N,6-N-trimethyl-2-N-propyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-ethyl-4-N,4-N,6-N-trimethyl-2-N-propyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80773692 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-N-ethyl-4-N,4-N,6-N-trimethyl-2-N-propyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCN(CC)c1nc(NC)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H22N6/c1-6-8-17(7-2)11-14-9(12-3)13-10(15-11)16(4)5/h6-8H2,1-5H3,(H,12,13,14,15) |
| InChIKey | DRCWLHXRISYWNI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |