C10H20N6S — CID 112667746
2-N,4-N,4-N,6-N-tetramethyl-2-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 112667746) has the molecular formula C10H20N6S and a molecular weight of 256.38 g/mol. Its IUPAC name is 2-N,4-N,4-N,6-N-tetramethyl-2-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N,6-N-tetramethyl-2-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 112667746 |
| Molecular Formula | C10H20N6S |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-N,4-N,4-N,6-N-tetramethyl-2-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N(C)C)nc(N(C)CCSC)n1 |
| InChI | InChI=1S/C10H20N6S/c1-11-8-12-9(15(2)3)14-10(13-8)16(4)6-7-17-5/h6-7H2,1-5H3,(H,11,12,13,14) |
| InChIKey | WCYLHQZWGIVQIG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |