C12H19N7S — CID 80812522
2-N,4-N,4-N,6-N-tetramethyl-2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80812522) has the molecular formula C12H19N7S and a molecular weight of 293.40 g/mol. Its IUPAC name is 2-N,4-N,4-N,6-N-tetramethyl-2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N,6-N-tetramethyl-2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80812522 |
| Molecular Formula | C12H19N7S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-N,4-N,4-N,6-N-tetramethyl-2-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N(C)C)nc(N(C)Cc2csc(C)n2)n1 |
| InChI | InChI=1S/C12H19N7S/c1-8-14-9(7-20-8)6-19(5)12-16-10(13-2)15-11(17-12)18(3)4/h7H,6H2,1-5H3,(H,13,15,16,17) |
| InChIKey | DBRMPHDDPZBCGG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |