C11H17N7S — CID 80807387
2-N,2-N,6-N-trimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80807387) has the molecular formula C11H17N7S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80807387 |
| Molecular Formula | C11H17N7S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCc2nc(C)cs2)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H17N7S/c1-7-6-19-8(14-7)5-13-10-15-9(12-2)16-11(17-10)18(3)4/h6H,5H2,1-4H3,(H2,12,13,15,16,17) |
| InChIKey | VTPIUKHYGTZQKL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |