C10H15N7S — CID 80807969
2-N,2-N-dimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80807969) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80807969 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1csc(CNc2nc(N)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C10H15N7S/c1-6-5-18-7(13-6)4-12-9-14-8(11)15-10(16-9)17(2)3/h5H,4H2,1-3H3,(H3,11,12,14,15,16) |
| InChIKey | BVSOWEBOYQWHKZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |