C9H13N7S — CID 80896903
6-hydrazinyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 80896903) has the molecular formula C9H13N7S and a molecular weight of 251.32 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-hydrazinyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80896903 |
| Molecular Formula | C9H13N7S |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-hydrazinyl-4-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1csc(CNc2cc(NN)nc(N)n2)n1 |
| InChI | InChI=1S/C9H13N7S/c1-5-4-17-8(13-5)3-12-6-2-7(16-11)15-9(10)14-6/h2,4H,3,11H2,1H3,(H4,10,12,14,15,16) |
| InChIKey | OARAUAMJGFCTGI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|