C13H20N6S — CID 80964799
2-tert-butyl-6-hydrazinyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine (PubChem CID 80964799) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-tert-butyl-6-hydrazinyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-hydrazinyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80964799 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-tert-butyl-6-hydrazinyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1csc(CNc2cc(NN)nc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C13H20N6S/c1-8-7-20-11(16-8)6-15-9-5-10(19-14)18-12(17-9)13(2,3)4/h5,7H,6,14H2,1-4H3,(H2,15,17,18,19) |
| InChIKey | JAYSWGAQYLXWIB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|