C9H9F3N6S — CID 106775511
6-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106775511) has the molecular formula C9H9F3N6S and a molecular weight of 290.27 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106775511 |
| Molecular Formula | C9H9F3N6S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 6-hydrazinyl-N-(1,3-thiazol-2-ylmethyl)-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(NCc2nccs2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F3N6S/c10-9(11,12)8-16-5(3-6(17-8)18-13)15-4-7-14-1-2-19-7/h1-3H,4,13H2,(H2,15,16,17,18) |
| InChIKey | IEJNOLRXQGSCQH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|