C13H22F3N5 — CID 106775571
6-hydrazinyl-2-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine (PubChem CID 106775571) has the molecular formula C13H22F3N5 and a molecular weight of 305.35 g/mol. Its IUPAC name is 6-hydrazinyl-2-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106775571 |
| Molecular Formula | C13H22F3N5 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 6-hydrazinyl-2-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyrimidin-4-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H22F3N5/c1-11(2,3)7-12(4,5)20-8-6-9(21-17)19-10(18-8)13(14,15)16/h6H,7,17H2,1-5H3,(H2,18,19,20,21) |
| InChIKey | ZYZTVSIYLCVWOV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|