C14H23F3N4 — CID 102720633
6-hydrazinyl-4-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyridin-2-amine (PubChem CID 102720633) has the molecular formula C14H23F3N4 and a molecular weight of 304.36 g/mol. Its IUPAC name is 6-hydrazinyl-4-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyridin-2-amine.
| Compound Name | 6-hydrazinyl-4-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720633 |
| Molecular Formula | C14H23F3N4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 6-hydrazinyl-4-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)pyridin-2-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C14H23F3N4/c1-12(2,3)8-13(4,5)20-10-6-9(14(15,16)17)7-11(19-10)21-18/h6-7H,8,18H2,1-5H3,(H2,19,20,21) |
| InChIKey | BALWIONBZDFNAJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|