C11H14ClF3N2 — CID 102715359
6-chloro-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715359) has the molecular formula C11H14ClF3N2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 6-chloro-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715359 |
| Molecular Formula | C11H14ClF3N2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-chloro-N-(2-methylbutan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC(C)(C)Nc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C11H14ClF3N2/c1-4-10(2,3)17-9-6-7(11(13,14)15)5-8(12)16-9/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | JUFKPCFAGWZNTM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|