C11H10ClF3N4O — CID 106421504
6-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 106421504) has the molecular formula C11H10ClF3N4O and a molecular weight of 306.68 g/mol. Its IUPAC name is 6-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106421504 |
| Molecular Formula | C11H10ClF3N4O |
| Molecular Weight | 306.68 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 6-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1nc(CCNc2cc(C(F)(F)F)cc(Cl)n2)no1 |
| InChI | InChI=1S/C11H10ClF3N4O/c1-6-17-9(19-20-6)2-3-16-10-5-7(11(13,14)15)4-8(12)18-10/h4-5H,2-3H2,1H3,(H,16,18) |
| InChIKey | WIJDDSLSRRLIMK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|