C12H10ClF3N2S — CID 102715638
6-chloro-N-(2-thiophen-3-ylethyl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715638) has the molecular formula C12H10ClF3N2S and a molecular weight of 306.74 g/mol. Its IUPAC name is 6-chloro-N-(2-thiophen-3-ylethyl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2-thiophen-3-ylethyl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715638 |
| Molecular Formula | C12H10ClF3N2S |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 6-chloro-N-(2-thiophen-3-ylethyl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cc(Cl)nc(NCCc2ccsc2)c1 |
| InChI | InChI=1S/C12H10ClF3N2S/c13-10-5-9(12(14,15)16)6-11(18-10)17-3-1-8-2-4-19-7-8/h2,4-7H,1,3H2,(H,17,18) |
| InChIKey | UBLSERVUAADMCO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|